C14H12ClN3S2 — CID 106895048
1-(5-chlorothiophen-2-yl)-N-(pyridazin-3-ylmethyl)-1-thiophen-2-ylmethanamine (PubChem CID 106895048) has the molecular formula C14H12ClN3S2 and a molecular weight of 321.86 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)-N-(pyridazin-3-ylmethyl)-1-thiophen-2-ylmethanamine.
| Compound Name | 1-(5-chlorothiophen-2-yl)-N-(pyridazin-3-ylmethyl)-1-thiophen-2-ylmethanamine |
|---|---|
| PubChem CID | 106895048 |
| Molecular Formula | C14H12ClN3S2 |
| Molecular Weight | 321.86 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)-N-(pyridazin-3-ylmethyl)-1-thiophen-2-ylmethanamine |
| SMILES | Clc1ccc(C(NCc2cccnn2)c2cccs2)s1 |
| InChI | InChI=1S/C14H12ClN3S2/c15-13-6-5-12(20-13)14(11-4-2-8-19-11)16-9-10-3-1-7-17-18-10/h1-8,14,16H,9H2 |
| InChIKey | DYDMLVZHAUKQTI-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.86 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |