C14H15ClF3NS2 — CID 115517345
N-[(5-chlorothiophen-2-yl)-thiophen-2-ylmethyl]-5,5,5-trifluoropentan-1-amine (PubChem CID 115517345) has the molecular formula C14H15ClF3NS2 and a molecular weight of 353.86 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)-thiophen-2-ylmethyl]-5,5,5-trifluoropentan-1-amine.
| Compound Name | N-[(5-chlorothiophen-2-yl)-thiophen-2-ylmethyl]-5,5,5-trifluoropentan-1-amine |
|---|---|
| PubChem CID | 115517345 |
| Molecular Formula | C14H15ClF3NS2 |
| Molecular Weight | 353.86 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)-thiophen-2-ylmethyl]-5,5,5-trifluoropentan-1-amine |
| SMILES | FC(F)(F)CCCCNC(c1cccs1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C14H15ClF3NS2/c15-12-6-5-11(21-12)13(10-4-3-9-20-10)19-8-2-1-7-14(16,17)18/h3-6,9,13,19H,1-2,7-8H2 |
| InChIKey | WIQVNLCAVVUHAF-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.86 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|