C14H14ClN3S2 — CID 61324705
N-[(5-chlorothiophen-2-yl)-thiophen-2-ylmethyl]-2-imidazol-1-ylethanamine (PubChem CID 61324705) has the molecular formula C14H14ClN3S2 and a molecular weight of 323.87 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)-thiophen-2-ylmethyl]-2-imidazol-1-ylethanamine.
| Compound Name | N-[(5-chlorothiophen-2-yl)-thiophen-2-ylmethyl]-2-imidazol-1-ylethanamine |
|---|---|
| PubChem CID | 61324705 |
| Molecular Formula | C14H14ClN3S2 |
| Molecular Weight | 323.87 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)-thiophen-2-ylmethyl]-2-imidazol-1-ylethanamine |
| SMILES | Clc1ccc(C(NCCn2ccnc2)c2cccs2)s1 |
| InChI | InChI=1S/C14H14ClN3S2/c15-13-4-3-12(20-13)14(11-2-1-9-19-11)17-6-8-18-7-5-16-10-18/h1-5,7,9-10,14,17H,6,8H2 |
| InChIKey | GDMTVNQQCDPSBT-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.87 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |