C15H16ClNS2 — CID 106226083
N-[(5-chlorothiophen-2-yl)-thiophen-2-ylmethyl]hex-1-yn-3-amine (PubChem CID 106226083) has the molecular formula C15H16ClNS2 and a molecular weight of 309.89 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)-thiophen-2-ylmethyl]hex-1-yn-3-amine.
| Compound Name | N-[(5-chlorothiophen-2-yl)-thiophen-2-ylmethyl]hex-1-yn-3-amine |
|---|---|
| PubChem CID | 106226083 |
| Molecular Formula | C15H16ClNS2 |
| Molecular Weight | 309.89 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)-thiophen-2-ylmethyl]hex-1-yn-3-amine |
| SMILES | C#CC(CCC)NC(c1cccs1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C15H16ClNS2/c1-3-6-11(4-2)17-15(12-7-5-10-18-12)13-8-9-14(16)19-13/h2,5,7-11,15,17H,3,6H2,1H3 |
| InChIKey | BGZZSTWKGBLLPL-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.89 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|