C14H16ClNS2 — CID 113466404
N-[(5-chlorothiophen-2-yl)-thiophen-2-ylmethyl]pent-4-en-2-amine (PubChem CID 113466404) has the molecular formula C14H16ClNS2 and a molecular weight of 297.88 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)-thiophen-2-ylmethyl]pent-4-en-2-amine.
| Compound Name | N-[(5-chlorothiophen-2-yl)-thiophen-2-ylmethyl]pent-4-en-2-amine |
|---|---|
| PubChem CID | 113466404 |
| Molecular Formula | C14H16ClNS2 |
| Molecular Weight | 297.88 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)-thiophen-2-ylmethyl]pent-4-en-2-amine |
| SMILES | C=CCC(C)NC(c1cccs1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C14H16ClNS2/c1-3-5-10(2)16-14(11-6-4-9-17-11)12-7-8-13(15)18-12/h3-4,6-10,14,16H,1,5H2,2H3 |
| InChIKey | ODFWOPKIPUOVGJ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.88 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|