C15H20ClNOS — CID 62117806
N-[(5-chlorothiophen-2-yl)-(furan-2-yl)methyl]hexan-3-amine (PubChem CID 62117806) has the molecular formula C15H20ClNOS and a molecular weight of 297.85 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)-(furan-2-yl)methyl]hexan-3-amine.
| Compound Name | N-[(5-chlorothiophen-2-yl)-(furan-2-yl)methyl]hexan-3-amine |
|---|---|
| PubChem CID | 62117806 |
| Molecular Formula | C15H20ClNOS |
| Molecular Weight | 297.85 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)-(furan-2-yl)methyl]hexan-3-amine |
| SMILES | CCCC(CC)NC(c1ccco1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C15H20ClNOS/c1-3-6-11(4-2)17-15(12-7-5-10-18-12)13-8-9-14(16)19-13/h5,7-11,15,17H,3-4,6H2,1-2H3 |
| InChIKey | OKZDZTIYWUDMCM-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.85 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |