C16H16ClNOS2 — CID 106009564
1-(5-chlorothiophen-2-yl)-N-[(5-ethylthiophen-2-yl)methyl]-1-(furan-2-yl)methanamine (PubChem CID 106009564) has the molecular formula C16H16ClNOS2 and a molecular weight of 337.90 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)-N-[(5-ethylthiophen-2-yl)methyl]-1-(furan-2-yl)methanamine.
| Compound Name | 1-(5-chlorothiophen-2-yl)-N-[(5-ethylthiophen-2-yl)methyl]-1-(furan-2-yl)methanamine |
|---|---|
| PubChem CID | 106009564 |
| Molecular Formula | C16H16ClNOS2 |
| Molecular Weight | 337.90 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)-N-[(5-ethylthiophen-2-yl)methyl]-1-(furan-2-yl)methanamine |
| SMILES | CCc1ccc(CNC(c2ccco2)c2ccc(Cl)s2)s1 |
| InChI | InChI=1S/C16H16ClNOS2/c1-2-11-5-6-12(20-11)10-18-16(13-4-3-9-19-13)14-7-8-15(17)21-14/h3-9,16,18H,2,10H2,1H3 |
| InChIKey | HUMWUKVBWIFPGU-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.90 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |