C13H17ClN2O3S2 — CID 106334631
2-[[(5-chlorothiophen-2-yl)-(furan-2-yl)methyl]amino]-N-ethylethanesulfonamide (PubChem CID 106334631) has the molecular formula C13H17ClN2O3S2 and a molecular weight of 348.88 g/mol. Its IUPAC name is 2-[[(5-chlorothiophen-2-yl)-(furan-2-yl)methyl]amino]-N-ethylethanesulfonamide.
| Compound Name | 2-[[(5-chlorothiophen-2-yl)-(furan-2-yl)methyl]amino]-N-ethylethanesulfonamide |
|---|---|
| PubChem CID | 106334631 |
| Molecular Formula | C13H17ClN2O3S2 |
| Molecular Weight | 348.88 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | 2-[[(5-chlorothiophen-2-yl)-(furan-2-yl)methyl]amino]-N-ethylethanesulfonamide |
| SMILES | CCNS(=O)(=O)CCNC(c1ccco1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C13H17ClN2O3S2/c1-2-16-21(17,18)9-7-15-13(10-4-3-8-19-10)11-5-6-12(14)20-11/h3-6,8,13,15-16H,2,7,9H2,1H3 |
| InChIKey | VCECRMKNPZCLAW-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.88 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |