C12H15ClN2OS — CID 60895734
N'-[(5-chlorothiophen-2-yl)-(furan-2-yl)methyl]propane-1,3-diamine (PubChem CID 60895734) has the molecular formula C12H15ClN2OS and a molecular weight of 270.79 g/mol. Its IUPAC name is N'-[(5-chlorothiophen-2-yl)-(furan-2-yl)methyl]propane-1,3-diamine.
| Compound Name | N'-[(5-chlorothiophen-2-yl)-(furan-2-yl)methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 60895734 |
| Molecular Formula | C12H15ClN2OS |
| Molecular Weight | 270.79 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | N'-[(5-chlorothiophen-2-yl)-(furan-2-yl)methyl]propane-1,3-diamine |
| SMILES | NCCCNC(c1ccco1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C12H15ClN2OS/c13-11-5-4-10(17-11)12(15-7-2-6-14)9-3-1-8-16-9/h1,3-5,8,12,15H,2,6-7,14H2 |
| InChIKey | KMTFZNOFELCZNW-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.79 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|