C15H19ClN2OS2 — CID 106324998
N-[(5-chlorothiophen-2-yl)-(furan-2-yl)methyl]-2-thiomorpholin-4-ylethanamine (PubChem CID 106324998) has the molecular formula C15H19ClN2OS2 and a molecular weight of 342.92 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)-(furan-2-yl)methyl]-2-thiomorpholin-4-ylethanamine.
| Compound Name | N-[(5-chlorothiophen-2-yl)-(furan-2-yl)methyl]-2-thiomorpholin-4-ylethanamine |
|---|---|
| PubChem CID | 106324998 |
| Molecular Formula | C15H19ClN2OS2 |
| Molecular Weight | 342.92 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)-(furan-2-yl)methyl]-2-thiomorpholin-4-ylethanamine |
| SMILES | Clc1ccc(C(NCCN2CCSCC2)c2ccco2)s1 |
| InChI | InChI=1S/C15H19ClN2OS2/c16-14-4-3-13(21-14)15(12-2-1-9-19-12)17-5-6-18-7-10-20-11-8-18/h1-4,9,15,17H,5-8,10-11H2 |
| InChIKey | HGDHQYDCUVCKBN-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.92 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |