C14H18ClN3OS — CID 83008954
N-[(5-chlorothiophen-2-yl)-(furan-2-yl)methyl]-4-methylpiperazin-1-amine (PubChem CID 83008954) has the molecular formula C14H18ClN3OS and a molecular weight of 311.84 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)-(furan-2-yl)methyl]-4-methylpiperazin-1-amine.
| Compound Name | N-[(5-chlorothiophen-2-yl)-(furan-2-yl)methyl]-4-methylpiperazin-1-amine |
|---|---|
| PubChem CID | 83008954 |
| Molecular Formula | C14H18ClN3OS |
| Molecular Weight | 311.84 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)-(furan-2-yl)methyl]-4-methylpiperazin-1-amine |
| SMILES | CN1CCN(NC(c2ccco2)c2ccc(Cl)s2)CC1 |
| InChI | InChI=1S/C14H18ClN3OS/c1-17-6-8-18(9-7-17)16-14(11-3-2-10-19-11)12-4-5-13(15)20-12/h2-5,10,14,16H,6-9H2,1H3 |
| InChIKey | IBEQGIHUUFGLLI-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 31.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.84 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |