C15H18ClNOS — CID 43756023
N-[(5-chlorothiophen-2-yl)-(furan-2-yl)methyl]cyclohexanamine (PubChem CID 43756023) has the molecular formula C15H18ClNOS and a molecular weight of 295.83 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)-(furan-2-yl)methyl]cyclohexanamine.
| Compound Name | N-[(5-chlorothiophen-2-yl)-(furan-2-yl)methyl]cyclohexanamine |
|---|---|
| PubChem CID | 43756023 |
| Molecular Formula | C15H18ClNOS |
| Molecular Weight | 295.83 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)-(furan-2-yl)methyl]cyclohexanamine |
| SMILES | Clc1ccc(C(NC2CCCCC2)c2ccco2)s1 |
| InChI | InChI=1S/C15H18ClNOS/c16-14-9-8-13(19-14)15(12-7-4-10-18-12)17-11-5-2-1-3-6-11/h4,7-11,15,17H,1-3,5-6H2 |
| InChIKey | JPFOLJZSBXOFQD-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.83 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |