C15H18ClNO2S — CID 106359565
[2-[[(5-chlorothiophen-2-yl)-(furan-2-yl)methyl]amino]cyclopentyl]methanol (PubChem CID 106359565) has the molecular formula C15H18ClNO2S and a molecular weight of 311.83 g/mol. Its IUPAC name is [2-[[(5-chlorothiophen-2-yl)-(furan-2-yl)methyl]amino]cyclopentyl]methanol.
| Compound Name | [2-[[(5-chlorothiophen-2-yl)-(furan-2-yl)methyl]amino]cyclopentyl]methanol |
|---|---|
| PubChem CID | 106359565 |
| Molecular Formula | C15H18ClNO2S |
| Molecular Weight | 311.83 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | [2-[[(5-chlorothiophen-2-yl)-(furan-2-yl)methyl]amino]cyclopentyl]methanol |
| SMILES | OCC1CCCC1NC(c1ccco1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C15H18ClNO2S/c16-14-7-6-13(20-14)15(12-5-2-8-19-12)17-11-4-1-3-10(11)9-18/h2,5-8,10-11,15,17-18H,1,3-4,9H2 |
| InChIKey | LMCNBZBAXZMNDA-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.83 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |