C16H20ClNO2S — CID 106124333
3-[[[(5-chlorothiophen-2-yl)-(furan-2-yl)methyl]amino]methyl]cyclohexan-1-ol (PubChem CID 106124333) has the molecular formula C16H20ClNO2S and a molecular weight of 325.86 g/mol. Its IUPAC name is 3-[[[(5-chlorothiophen-2-yl)-(furan-2-yl)methyl]amino]methyl]cyclohexan-1-ol.
| Compound Name | 3-[[[(5-chlorothiophen-2-yl)-(furan-2-yl)methyl]amino]methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 106124333 |
| Molecular Formula | C16H20ClNO2S |
| Molecular Weight | 325.86 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 3-[[[(5-chlorothiophen-2-yl)-(furan-2-yl)methyl]amino]methyl]cyclohexan-1-ol |
| SMILES | OC1CCCC(CNC(c2ccco2)c2ccc(Cl)s2)C1 |
| InChI | InChI=1S/C16H20ClNO2S/c17-15-7-6-14(21-15)16(13-5-2-8-20-13)18-10-11-3-1-4-12(19)9-11/h2,5-8,11-12,16,18-19H,1,3-4,9-10H2 |
| InChIKey | LRKWPMWRGLLHPG-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.86 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |