C16H22ClNOS — CID 43778058
N-[(5-chlorothiophen-2-yl)-(furan-2-yl)methyl]heptan-2-amine (PubChem CID 43778058) has the molecular formula C16H22ClNOS and a molecular weight of 311.88 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)-(furan-2-yl)methyl]heptan-2-amine.
| Compound Name | N-[(5-chlorothiophen-2-yl)-(furan-2-yl)methyl]heptan-2-amine |
|---|---|
| PubChem CID | 43778058 |
| Molecular Formula | C16H22ClNOS |
| Molecular Weight | 311.88 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)-(furan-2-yl)methyl]heptan-2-amine |
| SMILES | CCCCCC(C)NC(c1ccco1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C16H22ClNOS/c1-3-4-5-7-12(2)18-16(13-8-6-11-19-13)14-9-10-15(17)20-14/h6,8-12,16,18H,3-5,7H2,1-2H3 |
| InChIKey | ATSUMVNXTJRVGX-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.88 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|