C12H17NOS — CID 106229852
2-(hex-1-yn-3-ylamino)-1-thiophen-2-ylethanol (PubChem CID 106229852) has the molecular formula C12H17NOS and a molecular weight of 223.34 g/mol. Its IUPAC name is 2-(hex-1-yn-3-ylamino)-1-thiophen-2-ylethanol.
| Compound Name | 2-(hex-1-yn-3-ylamino)-1-thiophen-2-ylethanol |
|---|---|
| PubChem CID | 106229852 |
| Molecular Formula | C12H17NOS |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 2-(hex-1-yn-3-ylamino)-1-thiophen-2-ylethanol |
| SMILES | C#CC(CCC)NCC(O)c1cccs1 |
| InChI | InChI=1S/C12H17NOS/c1-3-6-10(4-2)13-9-11(14)12-7-5-8-15-12/h2,5,7-8,10-11,13-14H,3,6,9H2,1H3 |
| InChIKey | NHHXIFRJXOFUGQ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|