C13H23NO2S — CID 114164876
2-ethyl-2-[[(2-hydroxy-2-thiophen-2-ylethyl)amino]methyl]butan-1-ol (PubChem CID 114164876) has the molecular formula C13H23NO2S and a molecular weight of 257.40 g/mol. Its IUPAC name is 2-ethyl-2-[[(2-hydroxy-2-thiophen-2-ylethyl)amino]methyl]butan-1-ol.
| Compound Name | 2-ethyl-2-[[(2-hydroxy-2-thiophen-2-ylethyl)amino]methyl]butan-1-ol |
|---|---|
| PubChem CID | 114164876 |
| Molecular Formula | C13H23NO2S |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 2-ethyl-2-[[(2-hydroxy-2-thiophen-2-ylethyl)amino]methyl]butan-1-ol |
| SMILES | CCC(CC)(CO)CNCC(O)c1cccs1 |
| InChI | InChI=1S/C13H23NO2S/c1-3-13(4-2,10-15)9-14-8-11(16)12-6-5-7-17-12/h5-7,11,14-16H,3-4,8-10H2,1-2H3 |
| InChIKey | DYFUUJHSDXJMKJ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |