C15H27NOS — CID 81418518
2-ethyl-2-[(1-thiophen-2-ylbutylamino)methyl]butan-1-ol (PubChem CID 81418518) has the molecular formula C15H27NOS and a molecular weight of 269.45 g/mol. Its IUPAC name is 2-ethyl-2-[(1-thiophen-2-ylbutylamino)methyl]butan-1-ol.
| Compound Name | 2-ethyl-2-[(1-thiophen-2-ylbutylamino)methyl]butan-1-ol |
|---|---|
| PubChem CID | 81418518 |
| Molecular Formula | C15H27NOS |
| Molecular Weight | 269.45 g/mol |
| Exact Mass | 269.18 |
| IUPAC Name | 2-ethyl-2-[(1-thiophen-2-ylbutylamino)methyl]butan-1-ol |
| SMILES | CCCC(NCC(CC)(CC)CO)c1cccs1 |
| InChI | InChI=1S/C15H27NOS/c1-4-8-13(14-9-7-10-18-14)16-11-15(5-2,6-3)12-17/h7,9-10,13,16-17H,4-6,8,11-12H2,1-3H3 |
| InChIKey | UMCUNDHBXBCHLM-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.45 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |