C10H17N3OS — CID 77031722
N'-hydroxy-2-(1-thiophen-2-ylbutylamino)ethanimidamide (PubChem CID 77031722) has the molecular formula C10H17N3OS and a molecular weight of 227.33 g/mol. Its IUPAC name is N'-hydroxy-2-(1-thiophen-2-ylbutylamino)ethanimidamide.
| Compound Name | N'-hydroxy-2-(1-thiophen-2-ylbutylamino)ethanimidamide |
|---|---|
| PubChem CID | 77031722 |
| Molecular Formula | C10H17N3OS |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | N'-hydroxy-2-(1-thiophen-2-ylbutylamino)ethanimidamide |
| SMILES | CCCC(NCC(N)=NO)c1cccs1 |
| InChI | InChI=1S/C10H17N3OS/c1-2-4-8(9-5-3-6-15-9)12-7-10(11)13-14/h3,5-6,8,12,14H,2,4,7H2,1H3,(H2,11,13) |
| InChIKey | OQGUPVMPQAOUDL-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|