C11H19N3OS — CID 77031256
N'-hydroxy-3-(1-thiophen-2-ylpropylamino)butanimidamide (PubChem CID 77031256) has the molecular formula C11H19N3OS and a molecular weight of 241.36 g/mol. Its IUPAC name is N'-hydroxy-3-(1-thiophen-2-ylpropylamino)butanimidamide.
| Compound Name | N'-hydroxy-3-(1-thiophen-2-ylpropylamino)butanimidamide |
|---|---|
| PubChem CID | 77031256 |
| Molecular Formula | C11H19N3OS |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | N'-hydroxy-3-(1-thiophen-2-ylpropylamino)butanimidamide |
| SMILES | CCC(NC(C)CC(N)=NO)c1cccs1 |
| InChI | InChI=1S/C11H19N3OS/c1-3-9(10-5-4-6-16-10)13-8(2)7-11(12)14-15/h4-6,8-9,13,15H,3,7H2,1-2H3,(H2,12,14) |
| InChIKey | TYBURTWWUPFJLJ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|