C11H20N4OS — CID 77045251
N'-hydroxy-3-[1-(1,3-thiazol-2-yl)propylamino]pentanimidamide (PubChem CID 77045251) has the molecular formula C11H20N4OS and a molecular weight of 256.37 g/mol. Its IUPAC name is N'-hydroxy-3-[1-(1,3-thiazol-2-yl)propylamino]pentanimidamide.
| Compound Name | N'-hydroxy-3-[1-(1,3-thiazol-2-yl)propylamino]pentanimidamide |
|---|---|
| PubChem CID | 77045251 |
| Molecular Formula | C11H20N4OS |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | N'-hydroxy-3-[1-(1,3-thiazol-2-yl)propylamino]pentanimidamide |
| SMILES | CCC(CC(N)=NO)NC(CC)c1nccs1 |
| InChI | InChI=1S/C11H20N4OS/c1-3-8(7-10(12)15-16)14-9(4-2)11-13-5-6-17-11/h5-6,8-9,14,16H,3-4,7H2,1-2H3,(H2,12,15) |
| InChIKey | KMUIMSKNKCYIGG-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 83.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|