C10H24N4O — CID 82938574
3-[1-(dimethylamino)propan-2-ylamino]-N'-hydroxypentanimidamide (PubChem CID 82938574) has the molecular formula C10H24N4O and a molecular weight of 216.33 g/mol. Its IUPAC name is 3-[1-(dimethylamino)propan-2-ylamino]-N'-hydroxypentanimidamide.
| Compound Name | 3-[1-(dimethylamino)propan-2-ylamino]-N'-hydroxypentanimidamide |
|---|---|
| PubChem CID | 82938574 |
| Molecular Formula | C10H24N4O |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.20 |
| IUPAC Name | 3-[1-(dimethylamino)propan-2-ylamino]-N'-hydroxypentanimidamide |
| SMILES | CCC(CC(N)=NO)NC(C)CN(C)C |
| InChI | InChI=1S/C10H24N4O/c1-5-9(6-10(11)13-15)12-8(2)7-14(3)4/h8-9,12,15H,5-7H2,1-4H3,(H2,11,13) |
| InChIKey | PCWQVYQHJBHCBF-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 73.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|