C9H21N3O — CID 77026652
3-(butan-2-ylamino)-N'-hydroxypentanimidamide (PubChem CID 77026652) has the molecular formula C9H21N3O and a molecular weight of 187.29 g/mol. Its IUPAC name is 3-(butan-2-ylamino)-N'-hydroxypentanimidamide.
| Compound Name | 3-(butan-2-ylamino)-N'-hydroxypentanimidamide |
|---|---|
| PubChem CID | 77026652 |
| Molecular Formula | C9H21N3O |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.17 |
| IUPAC Name | 3-(butan-2-ylamino)-N'-hydroxypentanimidamide |
| SMILES | CCC(C)NC(CC)CC(N)=NO |
| InChI | InChI=1S/C9H21N3O/c1-4-7(3)11-8(5-2)6-9(10)12-13/h7-8,11,13H,4-6H2,1-3H3,(H2,10,12) |
| InChIKey | IRBJHJGHJUGRGV-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|