C9H20N4O2 — CID 76947908
1-(1-amino-1-hydroxyiminopentan-3-yl)-3-propan-2-ylurea (PubChem CID 76947908) has the molecular formula C9H20N4O2 and a molecular weight of 216.28 g/mol. Its IUPAC name is 1-(1-amino-1-hydroxyiminopentan-3-yl)-3-propan-2-ylurea.
| Compound Name | 1-(1-amino-1-hydroxyiminopentan-3-yl)-3-propan-2-ylurea |
|---|---|
| PubChem CID | 76947908 |
| Molecular Formula | C9H20N4O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 1-(1-amino-1-hydroxyiminopentan-3-yl)-3-propan-2-ylurea |
| SMILES | CCC(CC(N)=NO)NC(=O)NC(C)C |
| InChI | InChI=1S/C9H20N4O2/c1-4-7(5-8(10)13-15)12-9(14)11-6(2)3/h6-7,15H,4-5H2,1-3H3,(H2,10,13)(H2,11,12,14) |
| InChIKey | PNMROENAVKXIMY-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|