C8H14N2O2S2 — CID 124506403
N-[(1R)-1-(1,3-thiazol-2-yl)propyl]ethanesulfonamide (PubChem CID 124506403) has the molecular formula C8H14N2O2S2 and a molecular weight of 234.35 g/mol. Its IUPAC name is N-[(1R)-1-(1,3-thiazol-2-yl)propyl]ethanesulfonamide.
| Compound Name | N-[(1R)-1-(1,3-thiazol-2-yl)propyl]ethanesulfonamide |
|---|---|
| PubChem CID | 124506403 |
| Molecular Formula | C8H14N2O2S2 |
| Molecular Weight | 234.35 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | N-[(1R)-1-(1,3-thiazol-2-yl)propyl]ethanesulfonamide |
| SMILES | CC[C@@H](NS(=O)(=O)CC)c1nccs1 |
| InChI | InChI=1S/C8H14N2O2S2/c1-3-7(8-9-5-6-13-8)10-14(11,12)4-2/h5-7,10H,3-4H2,1-2H3/t7-/m1/s1 |
| InChIKey | LATVDNIVFHFDJL-SSDOTTSWSA-N |
| XLogP | 1.53 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.35 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |