C13H14Br2N2O2S2 — CID 81435158
2,5-dibromo-4-methyl-N-[1-(1,3-thiazol-2-yl)propyl]benzenesulfonamide (PubChem CID 81435158) has the molecular formula C13H14Br2N2O2S2 and a molecular weight of 454.21 g/mol. Its IUPAC name is 2,5-dibromo-4-methyl-N-[1-(1,3-thiazol-2-yl)propyl]benzenesulfonamide.
| Compound Name | 2,5-dibromo-4-methyl-N-[1-(1,3-thiazol-2-yl)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 81435158 |
| Molecular Formula | C13H14Br2N2O2S2 |
| Molecular Weight | 454.21 g/mol |
| Exact Mass | 451.89 |
| IUPAC Name | 2,5-dibromo-4-methyl-N-[1-(1,3-thiazol-2-yl)propyl]benzenesulfonamide |
| SMILES | CCC(NS(=O)(=O)c1cc(Br)c(C)cc1Br)c1nccs1 |
| InChI | InChI=1S/C13H14Br2N2O2S2/c1-3-11(13-16-4-5-20-13)17-21(18,19)12-7-9(14)8(2)6-10(12)15/h4-7,11,17H,3H2,1-2H3 |
| InChIKey | CQNMYMHQYUESMF-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.21 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |