C12H16N2O2S3 — CID 124595092
5-ethyl-N-[(1R)-1-(1,3-thiazol-2-yl)propyl]thiophene-2-sulfonamide (PubChem CID 124595092) has the molecular formula C12H16N2O2S3 and a molecular weight of 316.47 g/mol. Its IUPAC name is 5-ethyl-N-[(1R)-1-(1,3-thiazol-2-yl)propyl]thiophene-2-sulfonamide.
| Compound Name | 5-ethyl-N-[(1R)-1-(1,3-thiazol-2-yl)propyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 124595092 |
| Molecular Formula | C12H16N2O2S3 |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | 5-ethyl-N-[(1R)-1-(1,3-thiazol-2-yl)propyl]thiophene-2-sulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)N[C@H](CC)c2nccs2)s1 |
| InChI | InChI=1S/C12H16N2O2S3/c1-3-9-5-6-11(18-9)19(15,16)14-10(4-2)12-13-7-8-17-12/h5-8,10,14H,3-4H2,1-2H3/t10-/m1/s1 |
| InChIKey | UBVHFMCYQOKHKV-SNVBAGLBSA-N |
| XLogP | 3.20 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |