C13H15FN2O3S2 — CID 102562347
4-fluoro-3-methoxy-N-[1-(1,3-thiazol-2-yl)propyl]benzenesulfonamide (PubChem CID 102562347) has the molecular formula C13H15FN2O3S2 and a molecular weight of 330.41 g/mol. Its IUPAC name is 4-fluoro-3-methoxy-N-[1-(1,3-thiazol-2-yl)propyl]benzenesulfonamide.
| Compound Name | 4-fluoro-3-methoxy-N-[1-(1,3-thiazol-2-yl)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 102562347 |
| Molecular Formula | C13H15FN2O3S2 |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 4-fluoro-3-methoxy-N-[1-(1,3-thiazol-2-yl)propyl]benzenesulfonamide |
| SMILES | CCC(NS(=O)(=O)c1ccc(F)c(OC)c1)c1nccs1 |
| InChI | InChI=1S/C13H15FN2O3S2/c1-3-11(13-15-6-7-20-13)16-21(17,18)9-4-5-10(14)12(8-9)19-2/h4-8,11,16H,3H2,1-2H3 |
| InChIKey | SONWNDYIARERAM-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |