C11H13Br2NO4S — CID 81327907
(2R)-2-[(2,5-dibromo-4-methylphenyl)sulfonylamino]butanoic acid (PubChem CID 81327907) has the molecular formula C11H13Br2NO4S and a molecular weight of 415.10 g/mol. Its IUPAC name is (2R)-2-[(2,5-dibromo-4-methylphenyl)sulfonylamino]butanoic acid.
| Compound Name | (2R)-2-[(2,5-dibromo-4-methylphenyl)sulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 81327907 |
| Molecular Formula | C11H13Br2NO4S |
| Molecular Weight | 415.10 g/mol |
| Exact Mass | 412.89 |
| IUPAC Name | (2R)-2-[(2,5-dibromo-4-methylphenyl)sulfonylamino]butanoic acid |
| SMILES | CC[C@@H](NS(=O)(=O)c1cc(Br)c(C)cc1Br)C(=O)O |
| InChI | InChI=1S/C11H13Br2NO4S/c1-3-9(11(15)16)14-19(17,18)10-5-7(12)6(2)4-8(10)13/h4-5,9,14H,3H2,1-2H3,(H,15,16)/t9-/m1/s1 |
| InChIKey | DXBXENKXRQWIMI-SECBINFHSA-N |
| XLogP | 2.66 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.10 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |