C12H16FNO4S — CID 107326445
(2R)-2-[(4-fluoro-2,6-dimethylphenyl)sulfonylamino]butanoic acid (PubChem CID 107326445) has the molecular formula C12H16FNO4S and a molecular weight of 289.33 g/mol. Its IUPAC name is (2R)-2-[(4-fluoro-2,6-dimethylphenyl)sulfonylamino]butanoic acid.
| Compound Name | (2R)-2-[(4-fluoro-2,6-dimethylphenyl)sulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 107326445 |
| Molecular Formula | C12H16FNO4S |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | (2R)-2-[(4-fluoro-2,6-dimethylphenyl)sulfonylamino]butanoic acid |
| SMILES | CC[C@@H](NS(=O)(=O)c1c(C)cc(F)cc1C)C(=O)O |
| InChI | InChI=1S/C12H16FNO4S/c1-4-10(12(15)16)14-19(17,18)11-7(2)5-9(13)6-8(11)3/h5-6,10,14H,4H2,1-3H3,(H,15,16)/t10-/m1/s1 |
| InChIKey | RQSKQWDNOBEMIK-SNVBAGLBSA-N |
| XLogP | 1.58 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |