C13H20FN3O3S — CID 107328387
2-[(4-fluoro-2,6-dimethylphenyl)sulfonylamino]-N'-hydroxypentanimidamide (PubChem CID 107328387) has the molecular formula C13H20FN3O3S and a molecular weight of 317.39 g/mol. Its IUPAC name is 2-[(4-fluoro-2,6-dimethylphenyl)sulfonylamino]-N'-hydroxypentanimidamide.
| Compound Name | 2-[(4-fluoro-2,6-dimethylphenyl)sulfonylamino]-N'-hydroxypentanimidamide |
|---|---|
| PubChem CID | 107328387 |
| Molecular Formula | C13H20FN3O3S |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 2-[(4-fluoro-2,6-dimethylphenyl)sulfonylamino]-N'-hydroxypentanimidamide |
| SMILES | CCCC(NS(=O)(=O)c1c(C)cc(F)cc1C)C(N)=NO |
| InChI | InChI=1S/C13H20FN3O3S/c1-4-5-11(13(15)16-18)17-21(19,20)12-8(2)6-10(14)7-9(12)3/h6-7,11,17-18H,4-5H2,1-3H3,(H2,15,16) |
| InChIKey | MRNQWIMWPGCMES-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|