C10H10F3NO4S — CID 54881567
2-[(2,4,6-trifluorophenyl)sulfonylamino]butanoic acid (PubChem CID 54881567) has the molecular formula C10H10F3NO4S and a molecular weight of 297.25 g/mol. Its IUPAC name is 2-[(2,4,6-trifluorophenyl)sulfonylamino]butanoic acid.
| Compound Name | 2-[(2,4,6-trifluorophenyl)sulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 54881567 |
| Molecular Formula | C10H10F3NO4S |
| Molecular Weight | 297.25 g/mol |
| Exact Mass | 297.03 |
| IUPAC Name | 2-[(2,4,6-trifluorophenyl)sulfonylamino]butanoic acid |
| SMILES | CCC(NS(=O)(=O)c1c(F)cc(F)cc1F)C(=O)O |
| InChI | InChI=1S/C10H10F3NO4S/c1-2-8(10(15)16)14-19(17,18)9-6(12)3-5(11)4-7(9)13/h3-4,8,14H,2H2,1H3,(H,15,16) |
| InChIKey | TXXNOSDLAFIJGZ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.25 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |