C12H12F3NO2S — CID 115650481
2,4,6-trifluoro-N-hex-5-yn-3-ylbenzenesulfonamide (PubChem CID 115650481) has the molecular formula C12H12F3NO2S and a molecular weight of 291.29 g/mol. Its IUPAC name is 2,4,6-trifluoro-N-hex-5-yn-3-ylbenzenesulfonamide.
| Compound Name | 2,4,6-trifluoro-N-hex-5-yn-3-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 115650481 |
| Molecular Formula | C12H12F3NO2S |
| Molecular Weight | 291.29 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | 2,4,6-trifluoro-N-hex-5-yn-3-ylbenzenesulfonamide |
| SMILES | C#CCC(CC)NS(=O)(=O)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C12H12F3NO2S/c1-3-5-9(4-2)16-19(17,18)12-10(14)6-8(13)7-11(12)15/h1,6-7,9,16H,4-5H2,2H3 |
| InChIKey | FUXKBBFUBNCVBC-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.29 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|