C12H15FN2O4S2 — CID 115650539
2-fluoro-1-N-hex-5-yn-3-ylbenzene-1,4-disulfonamide (PubChem CID 115650539) has the molecular formula C12H15FN2O4S2 and a molecular weight of 334.39 g/mol. Its IUPAC name is 2-fluoro-1-N-hex-5-yn-3-ylbenzene-1,4-disulfonamide.
| Compound Name | 2-fluoro-1-N-hex-5-yn-3-ylbenzene-1,4-disulfonamide |
|---|---|
| PubChem CID | 115650539 |
| Molecular Formula | C12H15FN2O4S2 |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | 2-fluoro-1-N-hex-5-yn-3-ylbenzene-1,4-disulfonamide |
| SMILES | C#CCC(CC)NS(=O)(=O)c1ccc(S(N)(=O)=O)cc1F |
| InChI | InChI=1S/C12H15FN2O4S2/c1-3-5-9(4-2)15-21(18,19)12-7-6-10(8-11(12)13)20(14,16)17/h1,6-9,15H,4-5H2,2H3,(H2,14,16,17) |
| InChIKey | WCZKTHMACYTELH-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|