C11H12BrFN2O2S — CID 116527511
4-bromo-N-(1-cyanobutan-2-yl)-2-fluorobenzenesulfonamide (PubChem CID 116527511) has the molecular formula C11H12BrFN2O2S and a molecular weight of 335.20 g/mol. Its IUPAC name is 4-bromo-N-(1-cyanobutan-2-yl)-2-fluorobenzenesulfonamide.
| Compound Name | 4-bromo-N-(1-cyanobutan-2-yl)-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 116527511 |
| Molecular Formula | C11H12BrFN2O2S |
| Molecular Weight | 335.20 g/mol |
| Exact Mass | 333.98 |
| IUPAC Name | 4-bromo-N-(1-cyanobutan-2-yl)-2-fluorobenzenesulfonamide |
| SMILES | CCC(CC#N)NS(=O)(=O)c1ccc(Br)cc1F |
| InChI | InChI=1S/C11H12BrFN2O2S/c1-2-9(5-6-14)15-18(16,17)11-4-3-8(12)7-10(11)13/h3-4,7,9,15H,2,5H2,1H3 |
| InChIKey | GKXBVCLWVRKVOZ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.20 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |