C10H11FN2O6S — CID 82843747
(2R)-2-[(3-fluoro-4-nitrophenyl)sulfonylamino]butanoic acid (PubChem CID 82843747) has the molecular formula C10H11FN2O6S and a molecular weight of 306.27 g/mol. Its IUPAC name is (2R)-2-[(3-fluoro-4-nitrophenyl)sulfonylamino]butanoic acid.
| Compound Name | (2R)-2-[(3-fluoro-4-nitrophenyl)sulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 82843747 |
| Molecular Formula | C10H11FN2O6S |
| Molecular Weight | 306.27 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | (2R)-2-[(3-fluoro-4-nitrophenyl)sulfonylamino]butanoic acid |
| SMILES | CC[C@@H](NS(=O)(=O)c1ccc([N+](=O)[O-])c(F)c1)C(=O)O |
| InChI | InChI=1S/C10H11FN2O6S/c1-2-8(10(14)15)12-20(18,19)6-3-4-9(13(16)17)7(11)5-6/h3-5,8,12H,2H2,1H3,(H,14,15)/t8-/m1/s1 |
| InChIKey | RHZDIKSUYVWPQN-MRVPVSSYSA-N |
| XLogP | 0.88 |
| TPSA | 126.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.27 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|