C12H15FN2O5S — CID 43427428
2-[(4-acetamido-2-fluorophenyl)sulfonylamino]butanoic acid (PubChem CID 43427428) has the molecular formula C12H15FN2O5S and a molecular weight of 318.33 g/mol. Its IUPAC name is 2-[(4-acetamido-2-fluorophenyl)sulfonylamino]butanoic acid.
| Compound Name | 2-[(4-acetamido-2-fluorophenyl)sulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 43427428 |
| Molecular Formula | C12H15FN2O5S |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 2-[(4-acetamido-2-fluorophenyl)sulfonylamino]butanoic acid |
| SMILES | CCC(NS(=O)(=O)c1ccc(NC(C)=O)cc1F)C(=O)O |
| InChI | InChI=1S/C12H15FN2O5S/c1-3-10(12(17)18)15-21(19,20)11-5-4-8(6-9(11)13)14-7(2)16/h4-6,10,15H,3H2,1-2H3,(H,14,16)(H,17,18) |
| InChIKey | AVMWZNGOFAMQBO-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |