C11H18N2O2S — CID 64688740
tert-butyl N-[1-(1,3-thiazol-2-yl)propyl]carbamate (PubChem CID 64688740) has the molecular formula C11H18N2O2S and a molecular weight of 242.34 g/mol. Its IUPAC name is tert-butyl N-[1-(1,3-thiazol-2-yl)propyl]carbamate.
| Compound Name | tert-butyl N-[1-(1,3-thiazol-2-yl)propyl]carbamate |
|---|---|
| PubChem CID | 64688740 |
| Molecular Formula | C11H18N2O2S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | tert-butyl N-[1-(1,3-thiazol-2-yl)propyl]carbamate |
| SMILES | CCC(NC(=O)OC(C)(C)C)c1nccs1 |
| InChI | InChI=1S/C11H18N2O2S/c1-5-8(9-12-6-7-16-9)13-10(14)15-11(2,3)4/h6-8H,5H2,1-4H3,(H,13,14) |
| InChIKey | AKKRIUNLOPCFLN-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |