C12H18N2O3S — CID 165471034
tert-butyl N-[(2R)-1-oxo-1-(1,3-thiazol-2-yl)butan-2-yl]carbamate (PubChem CID 165471034) has the molecular formula C12H18N2O3S and a molecular weight of 270.35 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-oxo-1-(1,3-thiazol-2-yl)butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-oxo-1-(1,3-thiazol-2-yl)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 165471034 |
| Molecular Formula | C12H18N2O3S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | tert-butyl N-[(2R)-1-oxo-1-(1,3-thiazol-2-yl)butan-2-yl]carbamate |
| SMILES | CC[C@@H](NC(=O)OC(C)(C)C)C(=O)c1nccs1 |
| InChI | InChI=1S/C12H18N2O3S/c1-5-8(9(15)10-13-6-7-18-10)14-11(16)17-12(2,3)4/h6-8H,5H2,1-4H3,(H,14,16)/t8-/m1/s1 |
| InChIKey | BFJBADGHNBIXST-MRVPVSSYSA-N |
| XLogP | 2.63 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |