C15H24N4O4 — CID 95281054
2-(pyrimidin-2-ylamino)ethyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 95281054) has the molecular formula C15H24N4O4 and a molecular weight of 324.38 g/mol. Its IUPAC name is 2-(pyrimidin-2-ylamino)ethyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | 2-(pyrimidin-2-ylamino)ethyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 95281054 |
| Molecular Formula | C15H24N4O4 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 2-(pyrimidin-2-ylamino)ethyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | CC[C@H](NC(=O)OC(C)(C)C)C(=O)OCCNc1ncccn1 |
| InChI | InChI=1S/C15H24N4O4/c1-5-11(19-14(21)23-15(2,3)4)12(20)22-10-9-18-13-16-7-6-8-17-13/h6-8,11H,5,9-10H2,1-4H3,(H,19,21)(H,16,17,18)/t11-/m0/s1 |
| InChIKey | KUFGAUHLQMAYIC-NSHDSACASA-N |
| XLogP | 1.74 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|