About 2,2-dimethyl-3-[1-(1,3-thiazol-2-yl)propylamino]propanoic acid
2,2-dimethyl-3-[1-(1,3-thiazol-2-yl)propylamino]propanoic acid (PubChem CID 79624178) has the molecular formula C11H18N2O2S
and a molecular weight of 242.34 g/mol. Its IUPAC name is 2,2-dimethyl-3-[1-(1,3-thiazol-2-yl)propylamino]propanoic acid.
Analyze 2,2-dimethyl-3-[1-(1,3-thiazol-2-yl)propylamino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-3-[1-(1,3-thiazol-2-yl)propylamino]propanoic acid?
The IUPAC name of 2,2-dimethyl-3-[1-(1,3-thiazol-2-yl)propylamino]propanoic acid (CID 79624178) is 2,2-dimethyl-3-[1-(1,3-thiazol-2-yl)propylamino]propanoic acid.
What is the SMILES notation for 2,2-dimethyl-3-[1-(1,3-thiazol-2-yl)propylamino]propanoic acid?
The canonical SMILES for 2,2-dimethyl-3-[1-(1,3-thiazol-2-yl)propylamino]propanoic acid is CCC(NCC(C)(C)C(=O)O)c1nccs1.
What is the InChIKey of 2,2-dimethyl-3-[1-(1,3-thiazol-2-yl)propylamino]propanoic acid?
The InChIKey is FXPGUWGWVMSJAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O2S/c1-4-8(9-12-5-6-16-9)13-7-11(2,3)10(14)15/h5-6,8,13H,4,7H2,1-3H3,(H,14,15).
What are the key properties of 2,2-dimethyl-3-[1-(1,3-thiazol-2-yl)propylamino]propanoic acid?
2,2-dimethyl-3-[1-(1,3-thiazol-2-yl)propylamino]propanoic acid has a molecular weight of 242.34 g/mol, XLogP of 2.29, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-3-[1-(1,3-thiazol-2-yl)propylamino]propanoic acid is sourced from PubChem (CID 79624178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).