C12H18N2O2S — CID 103253927
(Z)-2-ethyl-4-[1-(1,3-thiazol-2-yl)propylamino]but-2-enoic acid (PubChem CID 103253927) has the molecular formula C12H18N2O2S and a molecular weight of 254.35 g/mol. Its IUPAC name is (Z)-2-ethyl-4-[1-(1,3-thiazol-2-yl)propylamino]but-2-enoic acid.
| Compound Name | (Z)-2-ethyl-4-[1-(1,3-thiazol-2-yl)propylamino]but-2-enoic acid |
|---|---|
| PubChem CID | 103253927 |
| Molecular Formula | C12H18N2O2S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | (Z)-2-ethyl-4-[1-(1,3-thiazol-2-yl)propylamino]but-2-enoic acid |
| SMILES | CC/C(=C/CNC(CC)c1nccs1)C(=O)O |
| InChI | InChI=1S/C12H18N2O2S/c1-3-9(12(15)16)5-6-13-10(4-2)11-14-7-8-17-11/h5,7-8,10,13H,3-4,6H2,1-2H3,(H,15,16)/b9-5- |
| InChIKey | AUTRKCLBWYACHI-UITAMQMPSA-N |
| XLogP | 2.60 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|