C10H14N2O2S — CID 103253931
methyl (E)-3-[1-(1,3-thiazol-2-yl)propylamino]prop-2-enoate (PubChem CID 103253931) has the molecular formula C10H14N2O2S and a molecular weight of 226.30 g/mol. Its IUPAC name is methyl (E)-3-[1-(1,3-thiazol-2-yl)propylamino]prop-2-enoate.
| Compound Name | methyl (E)-3-[1-(1,3-thiazol-2-yl)propylamino]prop-2-enoate |
|---|---|
| PubChem CID | 103253931 |
| Molecular Formula | C10H14N2O2S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | methyl (E)-3-[1-(1,3-thiazol-2-yl)propylamino]prop-2-enoate |
| SMILES | CCC(N/C=C/C(=O)OC)c1nccs1 |
| InChI | InChI=1S/C10H14N2O2S/c1-3-8(10-12-6-7-15-10)11-5-4-9(13)14-2/h4-8,11H,3H2,1-2H3/b5-4+ |
| InChIKey | QYISEMNOEYQRKL-SNAWJCMRSA-N |
| XLogP | 1.87 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|