C11H18N2O3S — CID 70144327
tert-butyl N-[3-hydroxy-3-(1,3-thiazol-2-yl)propyl]carbamate (PubChem CID 70144327) has the molecular formula C11H18N2O3S and a molecular weight of 258.34 g/mol. Its IUPAC name is tert-butyl N-[3-hydroxy-3-(1,3-thiazol-2-yl)propyl]carbamate.
| Compound Name | tert-butyl N-[3-hydroxy-3-(1,3-thiazol-2-yl)propyl]carbamate |
|---|---|
| PubChem CID | 70144327 |
| Molecular Formula | C11H18N2O3S |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | tert-butyl N-[3-hydroxy-3-(1,3-thiazol-2-yl)propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(O)c1nccs1 |
| InChI | InChI=1S/C11H18N2O3S/c1-11(2,3)16-10(15)13-5-4-8(14)9-12-6-7-17-9/h6-8,14H,4-5H2,1-3H3,(H,13,15) |
| InChIKey | YTZYUKUBMGPTPN-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |