C15H27N3O2S — CID 107253798
tert-butyl N-[2-[1-(1,3-thiazol-2-yl)ethylamino]pentyl]carbamate (PubChem CID 107253798) has the molecular formula C15H27N3O2S and a molecular weight of 313.47 g/mol. Its IUPAC name is tert-butyl N-[2-[1-(1,3-thiazol-2-yl)ethylamino]pentyl]carbamate.
| Compound Name | tert-butyl N-[2-[1-(1,3-thiazol-2-yl)ethylamino]pentyl]carbamate |
|---|---|
| PubChem CID | 107253798 |
| Molecular Formula | C15H27N3O2S |
| Molecular Weight | 313.47 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | tert-butyl N-[2-[1-(1,3-thiazol-2-yl)ethylamino]pentyl]carbamate |
| SMILES | CCCC(CNC(=O)OC(C)(C)C)NC(C)c1nccs1 |
| InChI | InChI=1S/C15H27N3O2S/c1-6-7-12(10-17-14(19)20-15(3,4)5)18-11(2)13-16-8-9-21-13/h8-9,11-12,18H,6-7,10H2,1-5H3,(H,17,19) |
| InChIKey | HNNAKLCDPAUUGC-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.47 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |