C10H16FNS — CID 80695322
N-(2-fluoroethyl)-1-thiophen-2-ylbutan-1-amine (PubChem CID 80695322) has the molecular formula C10H16FNS and a molecular weight of 201.31 g/mol. Its IUPAC name is N-(2-fluoroethyl)-1-thiophen-2-ylbutan-1-amine.
| Compound Name | N-(2-fluoroethyl)-1-thiophen-2-ylbutan-1-amine |
|---|---|
| PubChem CID | 80695322 |
| Molecular Formula | C10H16FNS |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | N-(2-fluoroethyl)-1-thiophen-2-ylbutan-1-amine |
| SMILES | CCCC(NCCF)c1cccs1 |
| InChI | InChI=1S/C10H16FNS/c1-2-4-9(12-7-6-11)10-5-3-8-13-10/h3,5,8-9,12H,2,4,6-7H2,1H3 |
| InChIKey | QSKXPBKNSSMKDB-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |