C15H17ClFNS — CID 114487528
N-[(3-chloro-2-fluorophenyl)methyl]-1-thiophen-2-ylbutan-1-amine (PubChem CID 114487528) has the molecular formula C15H17ClFNS and a molecular weight of 297.83 g/mol. Its IUPAC name is N-[(3-chloro-2-fluorophenyl)methyl]-1-thiophen-2-ylbutan-1-amine.
| Compound Name | N-[(3-chloro-2-fluorophenyl)methyl]-1-thiophen-2-ylbutan-1-amine |
|---|---|
| PubChem CID | 114487528 |
| Molecular Formula | C15H17ClFNS |
| Molecular Weight | 297.83 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | N-[(3-chloro-2-fluorophenyl)methyl]-1-thiophen-2-ylbutan-1-amine |
| SMILES | CCCC(NCc1cccc(Cl)c1F)c1cccs1 |
| InChI | InChI=1S/C15H17ClFNS/c1-2-5-13(14-8-4-9-19-14)18-10-11-6-3-7-12(16)15(11)17/h3-4,6-9,13,18H,2,5,10H2,1H3 |
| InChIKey | QBTUZCPTGOXLIF-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.83 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |