C15H16F3NS — CID 103792753
1-thiophen-2-yl-N-[(2,4,5-trifluorophenyl)methyl]butan-1-amine (PubChem CID 103792753) has the molecular formula C15H16F3NS and a molecular weight of 299.36 g/mol. Its IUPAC name is 1-thiophen-2-yl-N-[(2,4,5-trifluorophenyl)methyl]butan-1-amine.
| Compound Name | 1-thiophen-2-yl-N-[(2,4,5-trifluorophenyl)methyl]butan-1-amine |
|---|---|
| PubChem CID | 103792753 |
| Molecular Formula | C15H16F3NS |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 1-thiophen-2-yl-N-[(2,4,5-trifluorophenyl)methyl]butan-1-amine |
| SMILES | CCCC(NCc1cc(F)c(F)cc1F)c1cccs1 |
| InChI | InChI=1S/C15H16F3NS/c1-2-4-14(15-5-3-6-20-15)19-9-10-7-12(17)13(18)8-11(10)16/h3,5-8,14,19H,2,4,9H2,1H3 |
| InChIKey | WVEREPIAEYBJLF-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|