C13H21NO2S — CID 54962891
methyl 4-(1-thiophen-2-ylbutylamino)butanoate (PubChem CID 54962891) has the molecular formula C13H21NO2S and a molecular weight of 255.38 g/mol. Its IUPAC name is methyl 4-(1-thiophen-2-ylbutylamino)butanoate.
| Compound Name | methyl 4-(1-thiophen-2-ylbutylamino)butanoate |
|---|---|
| PubChem CID | 54962891 |
| Molecular Formula | C13H21NO2S |
| Molecular Weight | 255.38 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | methyl 4-(1-thiophen-2-ylbutylamino)butanoate |
| SMILES | CCCC(NCCCC(=O)OC)c1cccs1 |
| InChI | InChI=1S/C13H21NO2S/c1-3-6-11(12-7-5-10-17-12)14-9-4-8-13(15)16-2/h5,7,10-11,14H,3-4,6,8-9H2,1-2H3 |
| InChIKey | BVABVIIUWDJYPZ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.38 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|