C12H17NS — CID 63657512
N-propyl-1-thiophen-2-ylpent-4-yn-1-amine (PubChem CID 63657512) has the molecular formula C12H17NS and a molecular weight of 207.34 g/mol. Its IUPAC name is N-propyl-1-thiophen-2-ylpent-4-yn-1-amine.
| Compound Name | N-propyl-1-thiophen-2-ylpent-4-yn-1-amine |
|---|---|
| PubChem CID | 63657512 |
| Molecular Formula | C12H17NS |
| Molecular Weight | 207.34 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | N-propyl-1-thiophen-2-ylpent-4-yn-1-amine |
| SMILES | C#CCCC(NCCC)c1cccs1 |
| InChI | InChI=1S/C12H17NS/c1-3-5-7-11(13-9-4-2)12-8-6-10-14-12/h1,6,8,10-11,13H,4-5,7,9H2,2H3 |
| InChIKey | XRNOHSZSORPHFN-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.34 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|